C19H14N6O2 — CID 70023929
4-[4-(2H-tetrazol-5-yl)naphthalen-1-yl]-2,4-diazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione (PubChem CID 70023929) has the molecular formula C19H14N6O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-[4-(2H-tetrazol-5-yl)naphthalen-1-yl]-2,4-diazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione.
| Compound Name | 4-[4-(2H-tetrazol-5-yl)naphthalen-1-yl]-2,4-diazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 70023929 |
| Molecular Formula | C19H14N6O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[4-(2H-tetrazol-5-yl)naphthalen-1-yl]-2,4-diazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione |
| SMILES | O=C1C2=C3CCC(C3)N2C(=O)N1c1ccc(-c2nn[nH]n2)c2ccccc12 |
| InChI | InChI=1S/C19H14N6O2/c26-18-16-10-5-6-11(9-10)24(16)19(27)25(18)15-8-7-14(17-20-22-23-21-17)12-3-1-2-4-13(12)15/h1-4,7-8,11H,5-6,9H2,(H,20,21,22,23) |
| InChIKey | MZSFHXQWKYQPHY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|