C14H26N2O — CID 70024133
(1S,2R,3R)-3-pentan-3-yloxy-1-N-prop-2-enylcyclohex-4-ene-1,2-diamine (PubChem CID 70024133) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (1S,2R,3R)-3-pentan-3-yloxy-1-N-prop-2-enylcyclohex-4-ene-1,2-diamine.
| Compound Name | (1S,2R,3R)-3-pentan-3-yloxy-1-N-prop-2-enylcyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 70024133 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (1S,2R,3R)-3-pentan-3-yloxy-1-N-prop-2-enylcyclohex-4-ene-1,2-diamine |
| SMILES | C=CCN[C@H]1CC=C[C@@H](OC(CC)CC)[C@@H]1N |
| InChI | InChI=1S/C14H26N2O/c1-4-10-16-12-8-7-9-13(14(12)15)17-11(5-2)6-3/h4,7,9,11-14,16H,1,5-6,8,10,15H2,2-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | RNVKNVJUQNEKKV-BFHYXJOUSA-N |
| XLogP | 1.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|