About 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol
3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol (PubChem CID 70024174) has the molecular formula C23H28F2I2O2
and a molecular weight of 628.28 g/mol. Its IUPAC name is 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol.
Molecular Properties
| Compound Name | 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol |
| PubChem CID | 70024174 |
| Molecular Formula | C23H28F2I2O2 |
| Molecular Weight | 628.28 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol |
| SMILES | CCCC(F)c1cc(O)ccc1C(I)(c1ccc(O)cc1C(F)CCC)C(C)I |
| InChI | InChI=1S/C23H28F2I2O2/c1-4-6-21(24)17-12-15(28)8-10-19(17)23(27,14(3)26)20-11-9-16(29)13-18(20)22(25)7-5-2/h8-14,21-22,28-29H,4-7H2,1-3H3 |
| InChIKey | ZIBQJVQQKPONMF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.28 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol?
The IUPAC name of 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol (CID 70024174) is 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol.
What is the SMILES notation for 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol?
The canonical SMILES for 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol is CCCC(F)c1cc(O)ccc1C(I)(c1ccc(O)cc1C(F)CCC)C(C)I.
What is the InChIKey of 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol?
The InChIKey is ZIBQJVQQKPONMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2I2O2/c1-4-6-21(24)17-12-15(28)8-10-19(17)23(27,14(3)26)20-11-9-16(29)13-18(20)22(25)7-5-2/h8-14,21-22,28-29H,4-7H2,1-3H3.
What are the key properties of 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol?
3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol has a molecular weight of 628.28 g/mol, XLogP of 8.22, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-fluorobutyl)-4-[1-[2-(1-fluorobutyl)-4-hydroxyphenyl]-1,2-diiodopropyl]phenol is sourced from PubChem (CID 70024174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).