C24H32O9S — CID 70024247
[(2R)-2-[(2R,3S,4R,5S)-5-phenylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate (PubChem CID 70024247) has the molecular formula C24H32O9S and a molecular weight of 496.58 g/mol. Its IUPAC name is [(2R)-2-[(2R,3S,4R,5S)-5-phenylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate.
| Compound Name | [(2R)-2-[(2R,3S,4R,5S)-5-phenylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate |
|---|---|
| PubChem CID | 70024247 |
| Molecular Formula | C24H32O9S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [(2R)-2-[(2R,3S,4R,5S)-5-phenylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](OC(=O)CC)[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C24H32O9S/c1-5-17(25)29-14-16(30-18(26)6-2)21-22(31-19(27)7-3)23(32-20(28)8-4)24(33-21)34-15-12-10-9-11-13-15/h9-13,16,21-24H,5-8,14H2,1-4H3/t16-,21-,22+,23-,24+/m1/s1 |
| InChIKey | IVRGONPNRBMLLP-IGCYBFCNSA-N |
| XLogP | 3.42 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|