C17H20N2O — CID 70024601
6-(3-phenylprop-2-enoxymethyl)-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 70024601) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-(3-phenylprop-2-enoxymethyl)-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 6-(3-phenylprop-2-enoxymethyl)-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 70024601 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-(3-phenylprop-2-enoxymethyl)-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | C(=Cc1ccccc1)COCC1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C17H20N2O/c1-2-5-14(6-3-1)7-4-10-20-12-15-8-9-16-17(11-15)19-13-18-16/h1-7,13,15H,8-12H2,(H,18,19) |
| InChIKey | AYJUQKBGMBELKL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|