About 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride
2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride (PubChem CID 70024708) has the molecular formula C4H3Cl2NO2S
and a molecular weight of 200.05 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride |
| PubChem CID | 70024708 |
| Molecular Formula | C4H3Cl2NO2S |
| Molecular Weight | 200.05 g/mol |
| Exact Mass | 198.93 |
| IUPAC Name | 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1csc(Cl)n1 |
| InChI | InChI=1S/C4H2ClNO2S.ClH/c5-4-6-2(1-9-4)3(7)8;/h1H,(H,7,8);1H |
| InChIKey | DSKARTUPESYKRE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.05 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride?
The IUPAC name of 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride (CID 70024708) is 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride?
The canonical SMILES for 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride is Cl.O=C(O)c1csc(Cl)n1.
What is the InChIKey of 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride?
The InChIKey is DSKARTUPESYKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNO2S.ClH/c5-4-6-2(1-9-4)3(7)8;/h1H,(H,7,8);1H.
What are the key properties of 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride?
2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride has a molecular weight of 200.05 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 70024708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).