About [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate
[1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate (PubChem CID 70024749) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate.
Molecular Properties
| Compound Name | [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate |
| PubChem CID | 70024749 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate |
| SMILES | CC(=O)OC(CC(C)C)c1nc2c(cnc3ccccc32)[nH]1 |
| InChI | InChI=1S/C17H19N3O2/c1-10(2)8-15(22-11(3)21)17-19-14-9-18-13-7-5-4-6-12(13)16(14)20-17/h4-7,9-10,15H,8H2,1-3H3,(H,19,20) |
| InChIKey | VIXVKFRCHKSFAW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate?
The IUPAC name of [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate (CID 70024749) is [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate.
What is the SMILES notation for [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate?
The canonical SMILES for [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate is CC(=O)OC(CC(C)C)c1nc2c(cnc3ccccc32)[nH]1.
What is the InChIKey of [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate?
The InChIKey is VIXVKFRCHKSFAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c1-10(2)8-15(22-11(3)21)17-19-14-9-18-13-7-5-4-6-12(13)16(14)20-17/h4-7,9-10,15H,8H2,1-3H3,(H,19,20).
What are the key properties of [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate?
[1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate has a molecular weight of 297.36 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3H-imidazo[4,5-c]quinolin-2-yl)-3-methylbutyl] acetate is sourced from PubChem (CID 70024749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).