About 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine
3-chloro-[1,2]oxazolo[4,3-d]pyrimidine (PubChem CID 70024939) has the molecular formula C5H2ClN3O
and a molecular weight of 155.54 g/mol. Its IUPAC name is 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine |
| PubChem CID | 70024939 |
| Molecular Formula | C5H2ClN3O |
| Molecular Weight | 155.54 g/mol |
| Exact Mass | 154.99 |
| IUPAC Name | 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine |
| SMILES | Clc1onc2cncnc12 |
| InChI | InChI=1S/C5H2ClN3O/c6-5-4-3(9-10-5)1-7-2-8-4/h1-2H |
| InChIKey | REKNOIHFRSTULF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine?
The IUPAC name of 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine (CID 70024939) is 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine.
What is the SMILES notation for 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine?
The canonical SMILES for 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine is Clc1onc2cncnc12.
What is the InChIKey of 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine?
The InChIKey is REKNOIHFRSTULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClN3O/c6-5-4-3(9-10-5)1-7-2-8-4/h1-2H.
What are the key properties of 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine?
3-chloro-[1,2]oxazolo[4,3-d]pyrimidine has a molecular weight of 155.54 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-[1,2]oxazolo[4,3-d]pyrimidine is sourced from PubChem (CID 70024939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).