About 2-prop-2-enoxybenzoic acid;hydrochloride
2-prop-2-enoxybenzoic acid;hydrochloride (PubChem CID 70025071) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-prop-2-enoxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-prop-2-enoxybenzoic acid;hydrochloride |
| PubChem CID | 70025071 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-prop-2-enoxybenzoic acid;hydrochloride |
| SMILES | C=CCOc1ccccc1C(=O)O.Cl |
| InChI | InChI=1S/C10H10O3.ClH/c1-2-7-13-9-6-4-3-5-8(9)10(11)12;/h2-6H,1,7H2,(H,11,12);1H |
| InChIKey | OGJGEMRJOKSSBB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoxybenzoic acid;hydrochloride?
The IUPAC name of 2-prop-2-enoxybenzoic acid;hydrochloride (CID 70025071) is 2-prop-2-enoxybenzoic acid;hydrochloride.
What is the SMILES notation for 2-prop-2-enoxybenzoic acid;hydrochloride?
The canonical SMILES for 2-prop-2-enoxybenzoic acid;hydrochloride is C=CCOc1ccccc1C(=O)O.Cl.
What is the InChIKey of 2-prop-2-enoxybenzoic acid;hydrochloride?
The InChIKey is OGJGEMRJOKSSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.ClH/c1-2-7-13-9-6-4-3-5-8(9)10(11)12;/h2-6H,1,7H2,(H,11,12);1H.
What are the key properties of 2-prop-2-enoxybenzoic acid;hydrochloride?
2-prop-2-enoxybenzoic acid;hydrochloride has a molecular weight of 214.65 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoxybenzoic acid;hydrochloride is sourced from PubChem (CID 70025071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).