C26H31N5O — CID 70025998
2-[2-[1-(2-aminoethyl)piperidin-3-yl]ethynyl]-N-(3-methyl-4-phenoxyphenyl)-1H-pyrazin-4-amine (PubChem CID 70025998) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[2-[1-(2-aminoethyl)piperidin-3-yl]ethynyl]-N-(3-methyl-4-phenoxyphenyl)-1H-pyrazin-4-amine.
| Compound Name | 2-[2-[1-(2-aminoethyl)piperidin-3-yl]ethynyl]-N-(3-methyl-4-phenoxyphenyl)-1H-pyrazin-4-amine |
|---|---|
| PubChem CID | 70025998 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-[2-[1-(2-aminoethyl)piperidin-3-yl]ethynyl]-N-(3-methyl-4-phenoxyphenyl)-1H-pyrazin-4-amine |
| SMILES | Cc1cc(NN2C=CNC(C#CC3CCCN(CCN)C3)=C2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H31N5O/c1-21-18-23(11-12-26(21)32-25-7-3-2-4-8-25)29-31-17-14-28-24(20-31)10-9-22-6-5-15-30(19-22)16-13-27/h2-4,7-8,11-12,14,17-18,20,22,28-29H,5-6,13,15-16,19,27H2,1H3 |
| InChIKey | UBSKDLPOPZBRPC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|