C28H35NO4 — CID 70026267
methyl (6R,7aR)-3-tert-butyl-6-(4,4-diphenylbutyl)-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 70026267) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is methyl (6R,7aR)-3-tert-butyl-6-(4,4-diphenylbutyl)-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (6R,7aR)-3-tert-butyl-6-(4,4-diphenylbutyl)-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 70026267 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | methyl (6R,7aR)-3-tert-butyl-6-(4,4-diphenylbutyl)-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@@]12COC(C(C)(C)C)N1C(=O)[C@H](CCCC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C28H35NO4/c1-27(2,3)25-29-24(30)22(18-28(29,19-33-25)26(31)32-4)16-11-17-23(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-10,12-15,22-23,25H,11,16-19H2,1-4H3/t22-,25?,28-/m1/s1 |
| InChIKey | JESINTKAVWVFSA-RVFKSZKCSA-N |
| XLogP | 5.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |