About 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine
1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine (PubChem CID 70026960) has the molecular formula C20H38N2
and a molecular weight of 306.54 g/mol. Its IUPAC name is 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine.
Molecular Properties
| Compound Name | 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine |
| PubChem CID | 70026960 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine |
| SMILES | CC/C(C)=C(\C(C)(C)N1CCCCC1)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C20H38N2/c1-7-17(2)18(20(5,6)22-15-11-12-16-22)19(3,4)21-13-9-8-10-14-21/h7-16H2,1-6H3/b18-17+ |
| InChIKey | ODRJYROUUBBTSX-ISLYRVAYSA-N |
| XLogP | 4.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine?
The IUPAC name of 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine (CID 70026960) is 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine.
What is the SMILES notation for 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine?
The canonical SMILES for 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine is CC/C(C)=C(\C(C)(C)N1CCCCC1)C(C)(C)N1CCCC1.
What is the InChIKey of 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine?
The InChIKey is ODRJYROUUBBTSX-ISLYRVAYSA-N. The full InChI is InChI=1S/C20H38N2/c1-7-17(2)18(20(5,6)22-15-11-12-16-22)19(3,4)21-13-9-8-10-14-21/h7-16H2,1-6H3/b18-17+.
What are the key properties of 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine?
1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine has a molecular weight of 306.54 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2,4-dimethyl-3-(2-pyrrolidin-1-ylpropan-2-yl)hex-3-en-2-yl]piperidine is sourced from PubChem (CID 70026960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).