C19H32N2O4 — CID 70027143
(3R)-2,2,3-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione (PubChem CID 70027143) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3R)-2,2,3-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione.
| Compound Name | (3R)-2,2,3-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
|---|---|
| PubChem CID | 70027143 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3R)-2,2,3-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
| SMILES | C=C(CCC(=O)N1CCOCC1)[C@@H](C)C(C)(C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H32N2O4/c1-15(5-6-17(22)20-7-11-24-12-8-20)16(2)19(3,4)18(23)21-9-13-25-14-10-21/h16H,1,5-14H2,2-4H3/t16-/m1/s1 |
| InChIKey | GWUJDGGFUIGWSB-MRXNPFEDSA-N |
| XLogP | 1.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|