C13H18N2O3 — CID 70028426
1,3-bis(but-2-enyl)-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione (PubChem CID 70028426) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1,3-bis(but-2-enyl)-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione.
| Compound Name | 1,3-bis(but-2-enyl)-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione |
|---|---|
| PubChem CID | 70028426 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1,3-bis(but-2-enyl)-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione |
| SMILES | CC=CCN1C(=O)N(CC=CC)C2C(=O)OCC21 |
| InChI | InChI=1S/C13H18N2O3/c1-3-5-7-14-10-9-18-12(16)11(10)15(13(14)17)8-6-4-2/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | YYAHEWIBSAXKAQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|