C17H29NO3 — CID 70028434
trans-(1S,3S)-1-(4-acetamido-3-ethylpentyl)-3-ethenylcyclopentane-1-carboxylic acid (PubChem CID 70028434) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is trans-(1S,3S)-1-(4-acetamido-3-ethylpentyl)-3-ethenylcyclopentane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-1-(4-acetamido-3-ethylpentyl)-3-ethenylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 70028434 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | trans-(1S,3S)-1-(4-acetamido-3-ethylpentyl)-3-ethenylcyclopentane-1-carboxylic acid |
| SMILES | C=C[C@H]1CC[C@@](CCC(CC)C(C)NC(C)=O)(C(=O)O)C1 |
| InChI | InChI=1S/C17H29NO3/c1-5-14-7-9-17(11-14,16(20)21)10-8-15(6-2)12(3)18-13(4)19/h5,12,14-15H,1,6-11H2,2-4H3,(H,18,19)(H,20,21)/t12?,14-,15?,17-/m0/s1 |
| InChIKey | XLDLZRDRXWWODY-RZUWBANKSA-N |
| XLogP | 3.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|