C26H27NO7 — CID 70029171
(5R,6R)-5,6-dihydroxy-11,17,20-trimethoxy-2,7,7-trimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-13-one (PubChem CID 70029171) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is (5R,6R)-5,6-dihydroxy-11,17,20-trimethoxy-2,7,7-trimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-13-one.
| Compound Name | (5R,6R)-5,6-dihydroxy-11,17,20-trimethoxy-2,7,7-trimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-13-one |
|---|---|
| PubChem CID | 70029171 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (5R,6R)-5,6-dihydroxy-11,17,20-trimethoxy-2,7,7-trimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3,9,11,14,16,18,20-octaen-13-one |
| SMILES | COc1ccc(OC)c2cc3c(cc12)c(=O)c1c(OC)cc2c(c1n3C)[C@@H](O)[C@@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C26H27NO7/c1-26(2)25(30)24(29)21-19(34-26)11-18(33-6)20-22(21)27(3)15-10-13-12(9-14(15)23(20)28)16(31-4)7-8-17(13)32-5/h7-11,24-25,29-30H,1-6H3/t24-,25-/m1/s1 |
| InChIKey | QNCGIIHUCBBTIH-JWQCQUIFSA-N |
| XLogP | 3.44 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|