C16H27IN2O3SSi2 — CID 70029530
trimethylsilyl (6R,7R)-3-[(E)-3-iodoprop-1-enyl]-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 70029530) has the molecular formula C16H27IN2O3SSi2 and a molecular weight of 510.55 g/mol. Its IUPAC name is trimethylsilyl (6R,7R)-3-[(E)-3-iodoprop-1-enyl]-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | trimethylsilyl (6R,7R)-3-[(E)-3-iodoprop-1-enyl]-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 70029530 |
| Molecular Formula | C16H27IN2O3SSi2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | trimethylsilyl (6R,7R)-3-[(E)-3-iodoprop-1-enyl]-8-oxo-7-(trimethylsilylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | C[Si](C)(C)N[C@@H]1C(=O)N2C=C(/C=C/CI)C(C(=O)O[Si](C)(C)C)S[C@H]12 |
| InChI | InChI=1S/C16H27IN2O3SSi2/c1-24(2,3)18-12-14(20)19-10-11(8-7-9-17)13(23-15(12)19)16(21)22-25(4,5)6/h7-8,10,12-13,15,18H,9H2,1-6H3/b8-7+/t12-,13?,15-/m1/s1 |
| InChIKey | DHVILIURPUGDFM-MYZDZPAFSA-N |
| XLogP | 3.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|