About 2,3-bis(chloromethyl)-5,6-dimethylpyrazine
2,3-bis(chloromethyl)-5,6-dimethylpyrazine (PubChem CID 70029556) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is 2,3-bis(chloromethyl)-5,6-dimethylpyrazine.
Molecular Properties
| Compound Name | 2,3-bis(chloromethyl)-5,6-dimethylpyrazine |
| PubChem CID | 70029556 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,3-bis(chloromethyl)-5,6-dimethylpyrazine |
| SMILES | Cc1nc(CCl)c(CCl)nc1C |
| InChI | InChI=1S/C8H10Cl2N2/c1-5-6(2)12-8(4-10)7(3-9)11-5/h3-4H2,1-2H3 |
| InChIKey | BTYLOEMSAKUZFU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(chloromethyl)-5,6-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(chloromethyl)-5,6-dimethylpyrazine?
The IUPAC name of 2,3-bis(chloromethyl)-5,6-dimethylpyrazine (CID 70029556) is 2,3-bis(chloromethyl)-5,6-dimethylpyrazine.
What is the SMILES notation for 2,3-bis(chloromethyl)-5,6-dimethylpyrazine?
The canonical SMILES for 2,3-bis(chloromethyl)-5,6-dimethylpyrazine is Cc1nc(CCl)c(CCl)nc1C.
What is the InChIKey of 2,3-bis(chloromethyl)-5,6-dimethylpyrazine?
The InChIKey is BTYLOEMSAKUZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c1-5-6(2)12-8(4-10)7(3-9)11-5/h3-4H2,1-2H3.
What are the key properties of 2,3-bis(chloromethyl)-5,6-dimethylpyrazine?
2,3-bis(chloromethyl)-5,6-dimethylpyrazine has a molecular weight of 205.09 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(chloromethyl)-5,6-dimethylpyrazine is sourced from PubChem (CID 70029556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).