About 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid
2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid (PubChem CID 70029586) has the molecular formula C15H15NO5
and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid |
| PubChem CID | 70029586 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid |
| SMILES | COC1(CC(=O)O)C=CC(c2ccccc2)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15NO5/c1-21-15(10-14(17)18)8-7-12(9-13(15)16(19)20)11-5-3-2-4-6-11/h2-9,12H,10H2,1H3,(H,17,18) |
| InChIKey | VZOUAWDOBIDTDM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid (CID 70029586) is 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid is COC1(CC(=O)O)C=CC(c2ccccc2)C=C1[N+](=O)[O-].
What is the InChIKey of 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid?
The InChIKey is VZOUAWDOBIDTDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c1-21-15(10-14(17)18)8-7-12(9-13(15)16(19)20)11-5-3-2-4-6-11/h2-9,12H,10H2,1H3,(H,17,18).
What are the key properties of 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid?
2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid has a molecular weight of 289.29 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxy-2-nitro-4-phenylcyclohexa-2,5-dien-1-yl)acetic acid is sourced from PubChem (CID 70029586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).