azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid

C12H18N2O3S — CID 70030090

IUPACazane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid
SMILESN.O=C(O)C1CCCN(C(=O)Cc2cccs2)C1
InChIInChI=1S/C12H15NO3S.H3N/c14-11(7-10-4-2-6-17-10)13-5-1-3-9(8-13)12(15)16;/h2,4,6,9H,1,3,5,7-8H2,(H,15,16);1H3
InChIKeyNIYNQCVVEYDHST-UHFFFAOYSA-N
MW270.35 g/mol
LogP1.78
Rot. Bonds3

About azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid

azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid (PubChem CID 70030090) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Nameazane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid
PubChem CID70030090
Molecular FormulaC12H18N2O3S
Molecular Weight270.35 g/mol
Exact Mass270.10
IUPAC Nameazane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid
SMILESN.O=C(O)C1CCCN(C(=O)Cc2cccs2)C1
InChIInChI=1S/C12H15NO3S.H3N/c14-11(7-10-4-2-6-17-10)13-5-1-3-9(8-13)12(15)16;/h2,4,6,9H,1,3,5,7-8H2,(H,15,16);1H3
InChIKeyNIYNQCVVEYDHST-UHFFFAOYSA-N
XLogP1.78
TPSA92.61 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.35
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid?
The IUPAC name of azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid (CID 70030090) is azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid.
What is the SMILES notation for azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid?
The canonical SMILES for azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid is N.O=C(O)C1CCCN(C(=O)Cc2cccs2)C1.
What is the InChIKey of azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid?
The InChIKey is NIYNQCVVEYDHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3S.H3N/c14-11(7-10-4-2-6-17-10)13-5-1-3-9(8-13)12(15)16;/h2,4,6,9H,1,3,5,7-8H2,(H,15,16);1H3.
What are the key properties of azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid?
azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid has a molecular weight of 270.35 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 70030090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).