About 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid
4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid (PubChem CID 70030497) has the molecular formula C19H18N6O2
and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid |
| PubChem CID | 70030497 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(-n2nnnc2N(C)c2cccc3[nH]ccc23)cc(C)c1C(=O)O |
| InChI | InChI=1S/C19H18N6O2/c1-11-9-13(10-12(2)17(11)18(26)27)25-19(21-22-23-25)24(3)16-6-4-5-15-14(16)7-8-20-15/h4-10,20H,1-3H3,(H,26,27) |
| InChIKey | LXFVLUMOSBCSRM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid?
The IUPAC name of 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid (CID 70030497) is 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid is Cc1cc(-n2nnnc2N(C)c2cccc3[nH]ccc23)cc(C)c1C(=O)O.
What is the InChIKey of 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid?
The InChIKey is LXFVLUMOSBCSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6O2/c1-11-9-13(10-12(2)17(11)18(26)27)25-19(21-22-23-25)24(3)16-6-4-5-15-14(16)7-8-20-15/h4-10,20H,1-3H3,(H,26,27).
What are the key properties of 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid?
4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid has a molecular weight of 362.39 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[1H-indol-4-yl(methyl)amino]tetrazol-1-yl]-2,6-dimethylbenzoic acid is sourced from PubChem (CID 70030497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).