C19H19F2NO3S — CID 70031631
9-(2,3-difluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 70031631) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is 9-(2,3-difluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(2,3-difluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 70031631 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 9-(2,3-difluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1cccc(F)c1F)C1=C(CCS1(=O)=O)N2 |
| InChI | InChI=1S/C19H19F2NO3S/c1-19(2)8-6-12-15(18(19)23)14(10-4-3-5-11(20)16(10)21)17-13(22-12)7-9-26(17,24)25/h3-5,14,22H,6-9H2,1-2H3 |
| InChIKey | PYJRMTDWEVVKGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |