C22H22O6S — CID 70031740
ethyl (5E)-3-(2,3-dihydro-1-benzofuran-6-yloxy)-5-(ethoxymethylidene)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate (PubChem CID 70031740) has the molecular formula C22H22O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is ethyl (5E)-3-(2,3-dihydro-1-benzofuran-6-yloxy)-5-(ethoxymethylidene)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl (5E)-3-(2,3-dihydro-1-benzofuran-6-yloxy)-5-(ethoxymethylidene)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 70031740 |
| Molecular Formula | C22H22O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | ethyl (5E)-3-(2,3-dihydro-1-benzofuran-6-yloxy)-5-(ethoxymethylidene)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate |
| SMILES | CCO/C=C1\CCc2c(C(=O)OCC)sc(Oc3ccc4c(c3)OCC4)c2C1=O |
| InChI | InChI=1S/C22H22O6S/c1-3-25-12-14-6-8-16-18(19(14)23)22(29-20(16)21(24)26-4-2)28-15-7-5-13-9-10-27-17(13)11-15/h5,7,11-12H,3-4,6,8-10H2,1-2H3/b14-12+ |
| InChIKey | ZGHDOKPWUHEROH-WYMLVPIESA-N |
| XLogP | 4.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|