C35H32N2O4 — CID 70031762
N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-[2-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 70031762) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-[2-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-[2-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 70031762 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | N-benzyl-2-(1,3-dioxoisoindol-2-yl)-N-[2-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | COc1ccc(CC2CCc3ccccc3C2N(Cc2ccccc2)C(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C35H32N2O4/c1-41-28-19-15-24(16-20-28)21-27-18-17-26-11-5-6-12-29(26)33(27)36(22-25-9-3-2-4-10-25)32(38)23-37-34(39)30-13-7-8-14-31(30)35(37)40/h2-16,19-20,27,33H,17-18,21-23H2,1H3 |
| InChIKey | LNPSZZQEVJBSEO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|