About [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid
[[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid (PubChem CID 70032507) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid.
Molecular Properties
| Compound Name | [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid |
| PubChem CID | 70032507 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid |
| SMILES | O=C(O)NC(c1ccccc1)C1CCC(c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C20H23NO4/c22-16-10-11-17(18(23)12-16)13-6-8-15(9-7-13)19(21-20(24)25)14-4-2-1-3-5-14/h1-5,10-13,15,19,21-23H,6-9H2,(H,24,25) |
| InChIKey | OXBXLGGIGHJTQY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid?
The IUPAC name of [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid (CID 70032507) is [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid.
What is the SMILES notation for [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid?
The canonical SMILES for [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid is O=C(O)NC(c1ccccc1)C1CCC(c2ccc(O)cc2O)CC1.
What is the InChIKey of [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid?
The InChIKey is OXBXLGGIGHJTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c22-16-10-11-17(18(23)12-16)13-6-8-15(9-7-13)19(21-20(24)25)14-4-2-1-3-5-14/h1-5,10-13,15,19,21-23H,6-9H2,(H,24,25).
What are the key properties of [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid?
[[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid has a molecular weight of 341.41 g/mol, XLogP of 4.38, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(2,4-dihydroxyphenyl)cyclohexyl]-phenylmethyl]carbamic acid is sourced from PubChem (CID 70032507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).