About 4-methyl-1H-pyrrol-2-ol
4-methyl-1H-pyrrol-2-ol (PubChem CID 70032924) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is 4-methyl-1H-pyrrol-2-ol.
Molecular Properties
| Compound Name | 4-methyl-1H-pyrrol-2-ol |
| PubChem CID | 70032924 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 4-methyl-1H-pyrrol-2-ol |
| SMILES | Cc1c[nH]c(O)c1 |
| InChI | InChI=1S/C5H7NO/c1-4-2-5(7)6-3-4/h2-3,6-7H,1H3 |
| InChIKey | VWSIKLGQLQXNIX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-1H-pyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-pyrrol-2-ol?
The IUPAC name of 4-methyl-1H-pyrrol-2-ol (CID 70032924) is 4-methyl-1H-pyrrol-2-ol.
What is the SMILES notation for 4-methyl-1H-pyrrol-2-ol?
The canonical SMILES for 4-methyl-1H-pyrrol-2-ol is Cc1c[nH]c(O)c1.
What is the InChIKey of 4-methyl-1H-pyrrol-2-ol?
The InChIKey is VWSIKLGQLQXNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO/c1-4-2-5(7)6-3-4/h2-3,6-7H,1H3.
What are the key properties of 4-methyl-1H-pyrrol-2-ol?
4-methyl-1H-pyrrol-2-ol has a molecular weight of 97.12 g/mol, XLogP of 1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-pyrrol-2-ol is sourced from PubChem (CID 70032924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).