C10H9NO4 — CID 70033322
4,7-dihydroxy-5,6-dimethyl-1H-indole-2,3-dione (PubChem CID 70033322) has the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. Its IUPAC name is 4,7-dihydroxy-5,6-dimethyl-1H-indole-2,3-dione.
| Compound Name | 4,7-dihydroxy-5,6-dimethyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 70033322 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4,7-dihydroxy-5,6-dimethyl-1H-indole-2,3-dione |
| SMILES | Cc1c(C)c(O)c2c(c1O)NC(=O)C2=O |
| InChI | InChI=1S/C10H9NO4/c1-3-4(2)8(13)6-5(7(3)12)9(14)10(15)11-6/h12-13H,1-2H3,(H,11,14,15) |
| InChIKey | DGSXRVFXPKRDLH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|