About 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane
4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane (PubChem CID 70033442) has the molecular formula C26H24O2S
and a molecular weight of 400.54 g/mol. Its IUPAC name is 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane.
Molecular Properties
| Compound Name | 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane |
| PubChem CID | 70033442 |
| Molecular Formula | C26H24O2S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane |
| SMILES | C.CC1(C)CC=C(c2cccs2)c2cc(C#Cc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C25H20O2S.CH4/c1-25(2)14-13-20(23-4-3-15-28-23)21-16-18(9-12-22(21)25)6-5-17-7-10-19(11-8-17)24(26)27;/h3-4,7-13,15-16H,14H2,1-2H3,(H,26,27);1H4 |
| InChIKey | KQQBETGGEFCNNK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane?
The IUPAC name of 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane (CID 70033442) is 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane.
What is the SMILES notation for 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane?
The canonical SMILES for 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane is C.CC1(C)CC=C(c2cccs2)c2cc(C#Cc3ccc(C(=O)O)cc3)ccc21.
What is the InChIKey of 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane?
The InChIKey is KQQBETGGEFCNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O2S.CH4/c1-25(2)14-13-20(23-4-3-15-28-23)21-16-18(9-12-22(21)25)6-5-17-7-10-19(11-8-17)24(26)27;/h3-4,7-13,15-16H,14H2,1-2H3,(H,26,27);1H4.
What are the key properties of 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane?
4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane has a molecular weight of 400.54 g/mol, XLogP of 6.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5,5-dimethyl-8-thiophen-2-yl-6H-naphthalen-2-yl)ethynyl]benzoic acid;methane is sourced from PubChem (CID 70033442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).