C32H50N2O8Si2 — CID 70033908
1-[(6aR,8R,9R,9aR)-2,2,4,4-tetra(propan-2-yl)-9-propoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-(4-methylbenzoyl)pyrimidine-2,4-dione (PubChem CID 70033908) has the molecular formula C32H50N2O8Si2 and a molecular weight of 646.93 g/mol. Its IUPAC name is 1-[(6aR,8R,9R,9aR)-2,2,4,4-tetra(propan-2-yl)-9-propoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-(4-methylbenzoyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9R,9aR)-2,2,4,4-tetra(propan-2-yl)-9-propoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-(4-methylbenzoyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70033908 |
| Molecular Formula | C32H50N2O8Si2 |
| Molecular Weight | 646.93 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 1-[(6aR,8R,9R,9aR)-2,2,4,4-tetra(propan-2-yl)-9-propoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-(4-methylbenzoyl)pyrimidine-2,4-dione |
| SMILES | CCCO[C@@H]1[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@H]1n1ccc(=O)n(C(=O)c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C32H50N2O8Si2/c1-11-18-38-29-28-26(19-39-43(20(2)3,21(4)5)42-44(41-28,22(6)7)23(8)9)40-31(29)33-17-16-27(35)34(32(33)37)30(36)25-14-12-24(10)13-15-25/h12-17,20-23,26,28-29,31H,11,18-19H2,1-10H3/t26-,28-,29-,31-/m1/s1 |
| InChIKey | SUEAOLASHNSZOG-PYXCEVMUSA-N |
| XLogP | 5.66 |
| TPSA | 107.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|