C19H15O6- — CID 7003427
(2S)-2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate (PubChem CID 7003427) has the molecular formula C19H15O6- and a molecular weight of 339.32 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate.
| Compound Name | (2S)-2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
|---|---|
| PubChem CID | 7003427 |
| Molecular Formula | C19H15O6- |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2S)-2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
| SMILES | COc1ccc(C=C2Oc3cc(O[C@@H](C)C(=O)[O-])ccc3C2=O)cc1 |
| InChI | InChI=1S/C19H16O6/c1-11(19(21)22)24-14-7-8-15-16(10-14)25-17(18(15)20)9-12-3-5-13(23-2)6-4-12/h3-11H,1-2H3,(H,21,22)/p-1/t11-/m0/s1 |
| InChIKey | YAMNWOFORSYRRO-NSHDSACASA-M |
| XLogP | 1.83 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|