About [2-(aminomethyl)phenyl] acetate;oxalic acid
[2-(aminomethyl)phenyl] acetate;oxalic acid (PubChem CID 70035962) has the molecular formula C11H13NO6
and a molecular weight of 255.23 g/mol. Its IUPAC name is [2-(aminomethyl)phenyl] acetate;oxalic acid.
Molecular Properties
| Compound Name | [2-(aminomethyl)phenyl] acetate;oxalic acid |
| PubChem CID | 70035962 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [2-(aminomethyl)phenyl] acetate;oxalic acid |
| SMILES | CC(=O)Oc1ccccc1CN.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C2H2O4/c1-7(11)12-9-5-3-2-4-8(9)6-10;3-1(4)2(5)6/h2-5H,6,10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JMKFLGNFMQPYDT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(aminomethyl)phenyl] acetate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)phenyl] acetate;oxalic acid?
The IUPAC name of [2-(aminomethyl)phenyl] acetate;oxalic acid (CID 70035962) is [2-(aminomethyl)phenyl] acetate;oxalic acid.
What is the SMILES notation for [2-(aminomethyl)phenyl] acetate;oxalic acid?
The canonical SMILES for [2-(aminomethyl)phenyl] acetate;oxalic acid is CC(=O)Oc1ccccc1CN.O=C(O)C(=O)O.
What is the InChIKey of [2-(aminomethyl)phenyl] acetate;oxalic acid?
The InChIKey is JMKFLGNFMQPYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C2H2O4/c1-7(11)12-9-5-3-2-4-8(9)6-10;3-1(4)2(5)6/h2-5H,6,10H2,1H3;(H,3,4)(H,5,6).
What are the key properties of [2-(aminomethyl)phenyl] acetate;oxalic acid?
[2-(aminomethyl)phenyl] acetate;oxalic acid has a molecular weight of 255.23 g/mol, XLogP of 0.23, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)phenyl] acetate;oxalic acid is sourced from PubChem (CID 70035962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).