About ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate
ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate (PubChem CID 70036915) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate |
| PubChem CID | 70036915 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2[nH]c(CSC)nc2[nH]1 |
| InChI | InChI=1S/C10H13N3O2S/c1-3-15-10(14)7-4-6-9(12-7)13-8(11-6)5-16-2/h4,12H,3,5H2,1-2H3,(H,11,13) |
| InChIKey | XCOJCISARCEKKC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate?
The IUPAC name of ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate (CID 70036915) is ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate?
The canonical SMILES for ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate is CCOC(=O)c1cc2[nH]c(CSC)nc2[nH]1.
What is the InChIKey of ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate?
The InChIKey is XCOJCISARCEKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S/c1-3-15-10(14)7-4-6-9(12-7)13-8(11-6)5-16-2/h4,12H,3,5H2,1-2H3,(H,11,13).
What are the key properties of ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate?
ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate has a molecular weight of 239.30 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(methylsulfanylmethyl)-1,4-dihydropyrrolo[2,3-d]imidazole-5-carboxylate is sourced from PubChem (CID 70036915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).