C40H52N4 — CID 70036951
2,3,5,7-tetrapentylporphyrin (PubChem CID 70036951) has the molecular formula C40H52N4 and a molecular weight of 588.88 g/mol. Its IUPAC name is 2,3,5,7-tetrapentylporphyrin.
| Compound Name | 2,3,5,7-tetrapentylporphyrin |
|---|---|
| PubChem CID | 70036951 |
| Molecular Formula | C40H52N4 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | 2,3,5,7-tetrapentylporphyrin |
| SMILES | CCCCCC1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/CCCCC)C1=N2)C(CCCCC)=C5CCCCC)C=C4)C=C3 |
| InChI | InChI=1S/C40H52N4/c1-5-9-13-17-29-25-34-27-32-22-21-30(41-32)26-31-23-24-33(42-31)28-38-35(18-14-10-6-2)36(19-15-11-7-3)40(44-38)37(39(29)43-34)20-16-12-8-4/h21-28H,5-20H2,1-4H3/b30-26-,31-26-,32-27-,33-28-,34-27-,38-28-,39-37-,40-37- |
| InChIKey | JWOQHEPSLPQIHA-ZMXAJRBXSA-N |
| XLogP | 11.38 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|