About (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid
(5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid (PubChem CID 70037366) has the molecular formula C16H23BrN2O4
and a molecular weight of 387.27 g/mol. Its IUPAC name is (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid.
Molecular Properties
| Compound Name | (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid |
| PubChem CID | 70037366 |
| Molecular Formula | C16H23BrN2O4 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid |
| SMILES | Cc1c(N(C(=O)O)C(=O)O)nc(C(C)(C)C)c(Br)c1C(C)(C)C |
| InChI | InChI=1S/C16H23BrN2O4/c1-8-9(15(2,3)4)10(17)11(16(5,6)7)18-12(8)19(13(20)21)14(22)23/h1-7H3,(H,20,21)(H,22,23) |
| InChIKey | XAIJKEJQPJLVIE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid?
The IUPAC name of (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid (CID 70037366) is (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid.
What is the SMILES notation for (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid?
The canonical SMILES for (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid is Cc1c(N(C(=O)O)C(=O)O)nc(C(C)(C)C)c(Br)c1C(C)(C)C.
What is the InChIKey of (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid?
The InChIKey is XAIJKEJQPJLVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrN2O4/c1-8-9(15(2,3)4)10(17)11(16(5,6)7)18-12(8)19(13(20)21)14(22)23/h1-7H3,(H,20,21)(H,22,23).
What are the key properties of (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid?
(5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid has a molecular weight of 387.27 g/mol, XLogP of 4.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-4,6-ditert-butyl-3-methyl-2-pyridinyl)-carboxycarbamic acid is sourced from PubChem (CID 70037366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).