About (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole
(2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole (PubChem CID 7003741) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole |
| PubChem CID | 7003741 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole |
| SMILES | C[C@H]1C=C[C@H](C)N1 |
| InChI | InChI=1S/C6H11N/c1-5-3-4-6(2)7-5/h3-7H,1-2H3/t5-,6-/m0/s1 |
| InChIKey | TXQDHQBSNAJSHQ-WDSKDSINSA-N |
| XLogP | 0.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole?
The IUPAC name of (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole (CID 7003741) is (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole?
The canonical SMILES for (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole is C[C@H]1C=C[C@H](C)N1.
What is the InChIKey of (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole?
The InChIKey is TXQDHQBSNAJSHQ-WDSKDSINSA-N. The full InChI is InChI=1S/C6H11N/c1-5-3-4-6(2)7-5/h3-7H,1-2H3/t5-,6-/m0/s1.
What are the key properties of (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole?
(2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole has a molecular weight of 97.16 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-dimethyl-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 7003741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).