C17H23F3N2O2S — CID 7003793
(2R,6R)-2,6-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]morpholine-4-carboxamide (PubChem CID 7003793) has the molecular formula C17H23F3N2O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]morpholine-4-carboxamide.
| Compound Name | (2R,6R)-2,6-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 7003793 |
| Molecular Formula | C17H23F3N2O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]morpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NCCSCc2cccc(C(F)(F)F)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H23F3N2O2S/c1-12-9-22(10-13(2)24-12)16(23)21-6-7-25-11-14-4-3-5-15(8-14)17(18,19)20/h3-5,8,12-13H,6-7,9-11H2,1-2H3,(H,21,23)/t12-,13-/m1/s1 |
| InChIKey | FWGIJNWIOLSWLZ-CHWSQXEVSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|