C19H22IN — CID 70038189
1,1,4,7-tetramethyl-3-methylidene-2-phenylisoindole;hydroiodide (PubChem CID 70038189) has the molecular formula C19H22IN and a molecular weight of 391.30 g/mol. Its IUPAC name is 1,1,4,7-tetramethyl-3-methylidene-2-phenylisoindole;hydroiodide.
| Compound Name | 1,1,4,7-tetramethyl-3-methylidene-2-phenylisoindole;hydroiodide |
|---|---|
| PubChem CID | 70038189 |
| Molecular Formula | C19H22IN |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1,1,4,7-tetramethyl-3-methylidene-2-phenylisoindole;hydroiodide |
| SMILES | C=C1c2c(C)ccc(C)c2C(C)(C)N1c1ccccc1.I |
| InChI | InChI=1S/C19H21N.HI/c1-13-11-12-14(2)18-17(13)15(3)20(19(18,4)5)16-9-7-6-8-10-16;/h6-12H,3H2,1-2,4-5H3;1H |
| InChIKey | QPLMFHMJDUANEN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|