About [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate
[2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate (PubChem CID 70038415) has the molecular formula C21H25NO4S
and a molecular weight of 387.50 g/mol. Its IUPAC name is [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate.
Molecular Properties
| Compound Name | [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate |
| PubChem CID | 70038415 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate |
| SMILES | CCOC(C)C(=O)Oc1ccccc1OCCN1CCSc2ccccc21 |
| InChI | InChI=1S/C21H25NO4S/c1-3-24-16(2)21(23)26-19-10-6-5-9-18(19)25-14-12-22-13-15-27-20-11-7-4-8-17(20)22/h4-11,16H,3,12-15H2,1-2H3 |
| InChIKey | CGROOTVCPFISIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate?
The IUPAC name of [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate (CID 70038415) is [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate.
What is the SMILES notation for [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate?
The canonical SMILES for [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate is CCOC(C)C(=O)Oc1ccccc1OCCN1CCSc2ccccc21.
What is the InChIKey of [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate?
The InChIKey is CGROOTVCPFISIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO4S/c1-3-24-16(2)21(23)26-19-10-6-5-9-18(19)25-14-12-22-13-15-27-20-11-7-4-8-17(20)22/h4-11,16H,3,12-15H2,1-2H3.
What are the key properties of [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate?
[2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate has a molecular weight of 387.50 g/mol, XLogP of 4.01, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,3-dihydro-1,4-benzothiazin-4-yl)ethoxy]phenyl] 2-ethoxypropanoate is sourced from PubChem (CID 70038415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).