C26H33N3O6 — CID 70038521
3-hydroxy-4-[[3-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]phenyl]carbamoylamino]benzoic acid (PubChem CID 70038521) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-hydroxy-4-[[3-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]phenyl]carbamoylamino]benzoic acid.
| Compound Name | 3-hydroxy-4-[[3-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]phenyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 70038521 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 3-hydroxy-4-[[3-[[2-(3-methyl-2-propan-2-ylcyclohexyl)oxyacetyl]amino]phenyl]carbamoylamino]benzoic acid |
| SMILES | CC(C)C1C(C)CCCC1OCC(=O)Nc1cccc(NC(=O)Nc2ccc(C(=O)O)cc2O)c1 |
| InChI | InChI=1S/C26H33N3O6/c1-15(2)24-16(3)6-4-9-22(24)35-14-23(31)27-18-7-5-8-19(13-18)28-26(34)29-20-11-10-17(25(32)33)12-21(20)30/h5,7-8,10-13,15-16,22,24,30H,4,6,9,14H2,1-3H3,(H,27,31)(H,32,33)(H2,28,29,34) |
| InChIKey | FEIIHDVRFCOSGE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|