About 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid
4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 70038557) has the molecular formula C5H4FNO3
and a molecular weight of 145.09 g/mol. Its IUPAC name is 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 70038557 |
| Molecular Formula | C5H4FNO3 |
| Molecular Weight | 145.09 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1nocc1CF |
| InChI | InChI=1S/C5H4FNO3/c6-1-3-2-10-7-4(3)5(8)9/h2H,1H2,(H,8,9) |
| InChIKey | QYVZVGQKQAQROX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.09 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid (CID 70038557) is 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1nocc1CF.
What is the InChIKey of 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is QYVZVGQKQAQROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO3/c6-1-3-2-10-7-4(3)5(8)9/h2H,1H2,(H,8,9).
What are the key properties of 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid?
4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 145.09 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 70038557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).