About (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione
(2S)-2-aminohexanoic acid;imidazolidine-2,4-dione (PubChem CID 70039490) has the molecular formula C9H17N3O4
and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione |
| PubChem CID | 70039490 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione |
| SMILES | CCCC[C@H](N)C(=O)O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C6H13NO2.C3H4N2O2/c1-2-3-4-5(7)6(8)9;6-2-1-4-3(7)5-2/h5H,2-4,7H2,1H3,(H,8,9);1H2,(H2,4,5,6,7)/t5-;/m0./s1 |
| InChIKey | AELXMJRDLFELIP-JEDNCBNOSA-N |
| XLogP | -0.59 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione?
The IUPAC name of (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione (CID 70039490) is (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione.
What is the SMILES notation for (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione?
The canonical SMILES for (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione is CCCC[C@H](N)C(=O)O.O=C1CNC(=O)N1.
What is the InChIKey of (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione?
The InChIKey is AELXMJRDLFELIP-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H13NO2.C3H4N2O2/c1-2-3-4-5(7)6(8)9;6-2-1-4-3(7)5-2/h5H,2-4,7H2,1H3,(H,8,9);1H2,(H2,4,5,6,7)/t5-;/m0./s1.
What are the key properties of (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione?
(2S)-2-aminohexanoic acid;imidazolidine-2,4-dione has a molecular weight of 231.25 g/mol, XLogP of -0.59, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminohexanoic acid;imidazolidine-2,4-dione is sourced from PubChem (CID 70039490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).