About 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol
1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol (PubChem CID 70039716) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol.
Molecular Properties
| Compound Name | 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol |
| PubChem CID | 70039716 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol |
| SMILES | Cc1nn(C)c(NC(C)O)c1N |
| InChI | InChI=1S/C7H14N4O/c1-4-6(8)7(9-5(2)12)11(3)10-4/h5,9,12H,8H2,1-3H3 |
| InChIKey | UNVZERQWZINELP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol?
The IUPAC name of 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol (CID 70039716) is 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol.
What is the SMILES notation for 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol?
The canonical SMILES for 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol is Cc1nn(C)c(NC(C)O)c1N.
What is the InChIKey of 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol?
The InChIKey is UNVZERQWZINELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-4-6(8)7(9-5(2)12)11(3)10-4/h5,9,12H,8H2,1-3H3.
What are the key properties of 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol?
1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol has a molecular weight of 170.22 g/mol, XLogP of 0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]ethanol is sourced from PubChem (CID 70039716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).