C19H29N2O4P — CID 70039995
benzyl (2S)-1-[(2S)-2-(diethylphosphorylamino)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 70039995) has the molecular formula C19H29N2O4P and a molecular weight of 380.43 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-(diethylphosphorylamino)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-(diethylphosphorylamino)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70039995 |
| Molecular Formula | C19H29N2O4P |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-(diethylphosphorylamino)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCP(=O)(CC)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29N2O4P/c1-4-26(24,5-2)20-15(3)18(22)21-13-9-12-17(21)19(23)25-14-16-10-7-6-8-11-16/h6-8,10-11,15,17H,4-5,9,12-14H2,1-3H3,(H,20,24)/t15-,17-/m0/s1 |
| InChIKey | KTYYWQJLYLGPGW-RDJZCZTQSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|