C31H39N3O7 — CID 70040185
1-[3-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-dimethylpropyl]-2,4,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid (PubChem CID 70040185) has the molecular formula C31H39N3O7 and a molecular weight of 565.67 g/mol. Its IUPAC name is 1-[3-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-dimethylpropyl]-2,4,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-[3-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-dimethylpropyl]-2,4,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70040185 |
| Molecular Formula | C31H39N3O7 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | 1-[3-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-dimethylpropyl]-2,4,6-trimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid |
| SMILES | COc1ccc(CCN(C)CC(C)(C)CN2C(C)=C(C(=O)O)C(C)(c3cccc([N+](=O)[O-])c3)C(C(=O)O)=C2C)cc1 |
| InChI | InChI=1S/C31H39N3O7/c1-20-26(28(35)36)31(5,23-9-8-10-24(17-23)34(39)40)27(29(37)38)21(2)33(20)19-30(3,4)18-32(6)16-15-22-11-13-25(41-7)14-12-22/h8-14,17H,15-16,18-19H2,1-7H3,(H,35,36)(H,37,38) |
| InChIKey | VLFQEXUTYTVTQC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|