About [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol
[6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol (PubChem CID 70040192) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 70040192 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol |
| SMILES | COC1=CC(CO)C(CN)(OC)C=C1 |
| InChI | InChI=1S/C10H17NO3/c1-13-9-3-4-10(7-11,14-2)8(5-9)6-12/h3-5,8,12H,6-7,11H2,1-2H3 |
| InChIKey | NBUIRHRWOOSJKN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol (CID 70040192) is [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol is COC1=CC(CO)C(CN)(OC)C=C1.
What is the InChIKey of [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is NBUIRHRWOOSJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-13-9-3-4-10(7-11,14-2)8(5-9)6-12/h3-5,8,12H,6-7,11H2,1-2H3.
What are the key properties of [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol?
[6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 199.25 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(aminomethyl)-3,6-dimethoxycyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 70040192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).