About 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol
1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol (PubChem CID 70040303) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol.
Molecular Properties
| Compound Name | 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol |
| PubChem CID | 70040303 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol |
| SMILES | OCCCCCC(O)C1(CO)CCCCC1 |
| InChI | InChI=1S/C13H26O3/c14-10-6-1-3-7-12(16)13(11-15)8-4-2-5-9-13/h12,14-16H,1-11H2 |
| InChIKey | PYLFXNRIWZQITK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol?
The IUPAC name of 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol (CID 70040303) is 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol.
What is the SMILES notation for 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol?
The canonical SMILES for 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol is OCCCCCC(O)C1(CO)CCCCC1.
What is the InChIKey of 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol?
The InChIKey is PYLFXNRIWZQITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c14-10-6-1-3-7-12(16)13(11-15)8-4-2-5-9-13/h12,14-16H,1-11H2.
What are the key properties of 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol?
1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol has a molecular weight of 230.35 g/mol, XLogP of 1.84, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(hydroxymethyl)cyclohexyl]hexane-1,6-diol is sourced from PubChem (CID 70040303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).