C15H15N3O2S — CID 70040946
6-methyl-5-(2-oxo-3-propylidene-1H-indol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 70040946) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 6-methyl-5-(2-oxo-3-propylidene-1H-indol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 6-methyl-5-(2-oxo-3-propylidene-1H-indol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 70040946 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 6-methyl-5-(2-oxo-3-propylidene-1H-indol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | CCC=C1C(=O)Nc2ccc(C3=NNC(=O)SC3C)cc21 |
| InChI | InChI=1S/C15H15N3O2S/c1-3-4-10-11-7-9(5-6-12(11)16-14(10)19)13-8(2)21-15(20)18-17-13/h4-8H,3H2,1-2H3,(H,16,19)(H,18,20) |
| InChIKey | APVUDVBWNWUOON-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|