C14H9N3 — CID 70040959
2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11,13-hexaen-2-ylidene)acetonitrile (PubChem CID 70040959) has the molecular formula C14H9N3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11,13-hexaen-2-ylidene)acetonitrile.
| Compound Name | 2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11,13-hexaen-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 70040959 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(3,9-diazatricyclo[8.4.0.01,5]tetradeca-3,5,7,9,11,13-hexaen-2-ylidene)acetonitrile |
| SMILES | N#CC=C1N=CC2=CC=CN=C3C=CC=CC213 |
| InChI | InChI=1S/C14H9N3/c15-8-6-13-14-7-2-1-5-12(14)16-9-3-4-11(14)10-17-13/h1-7,9-10H |
| InChIKey | HPOVEOWGKDLNPR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|