About 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid
1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid (PubChem CID 70041127) has the molecular formula C15H26N5O4P
and a molecular weight of 371.38 g/mol. Its IUPAC name is 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid.
Molecular Properties
| Compound Name | 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid |
| PubChem CID | 70041127 |
| Molecular Formula | C15H26N5O4P |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid |
| SMILES | CCCc1nc(N)c2nc(CCC)n(CC(C)OCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C15H26N5O4P/c1-4-6-11-17-14(16)13-15(18-11)20(12(19-13)7-5-2)8-10(3)24-9-25(21,22)23/h10H,4-9H2,1-3H3,(H2,16,17,18)(H2,21,22,23) |
| InChIKey | UATYEOYZRYBYQA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid?
The IUPAC name of 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid (CID 70041127) is 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid.
What is the SMILES notation for 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid?
The canonical SMILES for 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid is CCCc1nc(N)c2nc(CCC)n(CC(C)OCP(=O)(O)O)c2n1.
What is the InChIKey of 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid?
The InChIKey is UATYEOYZRYBYQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N5O4P/c1-4-6-11-17-14(16)13-15(18-11)20(12(19-13)7-5-2)8-10(3)24-9-25(21,22)23/h10H,4-9H2,1-3H3,(H2,16,17,18)(H2,21,22,23).
What are the key properties of 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid?
1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid has a molecular weight of 371.38 g/mol, XLogP of 1.85, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2,8-dipropylpurin-9-yl)propan-2-yloxymethylphosphonic acid is sourced from PubChem (CID 70041127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).