About 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine
8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine (PubChem CID 70041180) has the molecular formula C8H11N7
and a molecular weight of 205.23 g/mol. Its IUPAC name is 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine.
Molecular Properties
| Compound Name | 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine |
| PubChem CID | 70041180 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine |
| SMILES | C=CC(N)Nc1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C8H11N7/c1-2-4(9)13-8-14-5-6(10)11-3-12-7(5)15-8/h2-4H,1,9H2,(H4,10,11,12,13,14,15) |
| InChIKey | YFOAQNPRMHMWSZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine?
The IUPAC name of 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine (CID 70041180) is 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine.
What is the SMILES notation for 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine?
The canonical SMILES for 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine is C=CC(N)Nc1nc2ncnc(N)c2[nH]1.
What is the InChIKey of 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine?
The InChIKey is YFOAQNPRMHMWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N7/c1-2-4(9)13-8-14-5-6(10)11-3-12-7(5)15-8/h2-4H,1,9H2,(H4,10,11,12,13,14,15).
What are the key properties of 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine?
8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine has a molecular weight of 205.23 g/mol, XLogP of -0.18, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-(1-aminoprop-2-enyl)-7H-purine-6,8-diamine is sourced from PubChem (CID 70041180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).